Detailansicht

Ionothermal versus hydrothermal synthesis at the example of the CdO-MO-As2O5-(H2O/IL)-system
Sabrina Stefanie Gerger
Art der Arbeit
Masterarbeit
Universität
Universität Wien
Fakultät
Fakultät für Geowissenschaften, Geographie und Astronomie
Studiumsbezeichnung bzw. Universitätlehrgang (ULG)
Masterstudium Erdwissenschaften
Betreuer*in
Ronald Miletich-Pawliczek
Mitbetreuer*in
Tamara Dordević
Volltext herunterladen
Volltext in Browser öffnen
Alle Rechte vorbehalten / All rights reserved
DOI
10.25365/thesis.42711
URN
urn:nbn:at:at-ubw:1-28694.00910.914668-0
Link zu u:search
(Print-Exemplar eventuell in Bibliothek verfügbar)

Abstracts

Abstract
(Deutsch)
Im Rahmen von systematischen Untersuchungen von mineralähnlichen Arsenaten in dem System CdO-MO-As2O5-(H2O/IL) wurden zwei Polymorphe von (C6H11N2)2[CdBr4], alpha-(C6H11N2)2[CdBr4] (1) und beta-(C6H11N2)2[CdBr4] (2) und ein Zink-Arsenat, Zn9(AsO4)6(H2O)4 (3), unter ionothermalen Bedingungen mit der ionischen Flüssigkeit (IF) 1-Ethyl-3-Methylimidazolium Bromid, C6H11BrN2, synthetisiert. Weiters wurde ein Ni-haltiges, mineralähnliches Cd-Arsenat, Cd4.65Ni0.35(H2O)4(AsO4)2(HAsO4)2 (4), unter hydrothermalen Bedingungen synthesisiert. Die unterschiedlichen Ansätze der Synthese von mineralähnlichen Arsenaten, die Temperaturbehandlung und die Rolle der unterschiedlichen Lösungsmittel wurden auch behandelt. Alle Verbindungen wurden mithilfe von Einkristalldiffrakometrie, SEM/EDS und Schwingungsspektroskopie charakterisiert: 1 monoklin, P21/c, a = 13,975(3) Å, b = 10,343(2) Å, c = 14,895(3) Å, beta = 94,35(3)°, V = 2146,8(8) Å3, Z = 4, R1 = 0,039; 2 tetragonal, I41 /a, a = 14,863(2) Å, c = 20,600(2) Å, V = 4550,9(16) Å3, Z = 22, R1 = 0,042; 3 triklin, P1 ̅, a = 6,6983(13) Å, b = 9,1885(18) Å, c = 10,146(2) Å, alpha = 69,44(3)°, beta = 94,35(3)°, gamma = 75,78(3)° V = 560,6(2) Å3, Z = 1, R1 = 0,0287; 4 monoclinic C2/c, a = 18,375(4) Å, b = 9,5395(19) Å, c = 9,977(2) Å, beta = 96,19(3)°, V = 1738,6(6) Å3, Z = 4, R1 = 0,0296. Zn9(AsO4)6(H2O)4 (3) ist eine bekannte Verbindung, wurde aber das erste Mal unter ionothermalen Bedingungen synthetisiert und die Positionen der Wasserstoffatome wurde bestimmt und verfeinert. Cd4.65Ni0.35(H2O)4(AsO4)2(HAsO4)2 (4) ist ein neues Ni-haltiges Cd-Arsenat mit einer mineralähnlichen Struktur.
Abstract
(Englisch)
Within the scope of systematic research on mineral-related arsenates in the system CdO-MO-As2O5-(H2O/IL) the two polymorphs of (C6H11N2)2[CdBr4], alpha-(C6H11N2)2[CdBr4] (1) and beta-(C6H11N2)2[CdBr4] (2) and a Zn-containing arsenate, Zn9(AsO4)6(H2O)4 (3), were synthesised under ionothermal conditions using the ionic liquid (IL) 1-ethyl-3-methylimidazolium bromide, C6H11N2Br. Furthermore, a new Ni-bearing mineral-like Cd-arsenate, Cd4.65Ni0.35(H2O)4(AsO4)2(HAsO4)2 (4), has been synthesised under hydrothermal conditions. The different approaches in the synthesis of mineral-related arsenates, the temperature treatment and the role of the different solvents were also disscussed. All compounds were characterised using single-crystal X-ray diffraction, SEM/EDS analysis and vibrational spectroscopy: 1 monoclinic, P21/c, a = 13.975(3) Å, b = 10.343(2) Å, c = 14.895(3) Å, beta = 94.35(3)°, V = 2146.8(8) Å3, Z = 4, R1 = 0.039; 2 tetragonal, I41 /a, a = 14.863(2) Å, c = 20.600(2) Å, V = 4550.9(16) Å3, Z = 22, R1 = 0.042; 3 triclinic, P1 ̅, a = 6.6983(13) Å, b = 9.1885(18) Å, c = 10.146(2) Å, alpha = 69.44(3)°, beta = 94.35(3)°, gamma = 75.78(3)° V = 560.6(2) Å3, Z = 1, R1 = 0.0287; 4 monoclinic C2/c, a = 18.375(4) Å, b = 9.5395(19) Å, c = 9.977(2) Å, beta = 96.19(3)°, V = 1738.6(6) Å3, Z = 4, R1 = 0.0296. Zn9(AsO4)6(H2O)4 (3) is a known compound but for the first time synthesised under ionothermal conditions using the ionic liquid [emim]Br as solvent and the positions of the hydrogen atoms have been determined and refined. Cd4.65Ni0.35(H2O)4(AsO4)2(HAsO4)2 (4) is a new nickel-bearing cadmium-arsenate with a mineral-like structure.

Schlagwörter

Schlagwörter
(Englisch)
Ionothermal synthesis hydrothermal synthesis inorganic-organic hybrid structure arsenates
Schlagwörter
(Deutsch)
Ionothermalsynthese Hydrothermalsynthese Anorganisch-organische Hybridstruktur Arsenate
Autor*innen
Sabrina Stefanie Gerger
Haupttitel (Englisch)
Ionothermal versus hydrothermal synthesis at the example of the CdO-MO-As2O5-(H2O/IL)-system
Paralleltitel (Deutsch)
Ionothermal- versus Hydrothermalsynthese am Beispiel vom CdO-MO-As2O5-(H2O/IL)-System
Publikationsjahr
2016
Umfangsangabe
85 Seiten : Illustrationen, Diagramme
Sprache
Englisch
Beurteiler*in
Ronald Miletich-Pawliczek
Klassifikationen
38 Geowissenschaften > 38.30 Mineralogie ,
38 Geowissenschaften > 38.31 Kristallographie
AC Nummer
AC13259742
Utheses ID
37805
Studienkennzahl
UA | 066 | 815 | |
Universität Wien, Universitätsbibliothek, 1010 Wien, Universitätsring 1